C27H32N2O3S2 — CID 30175914
2-[N-(benzenesulfonyl)-2,5-dimethylanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30175914) has the molecular formula C27H32N2O3S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethylanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethylanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30175914 |
| Molecular Formula | C27H32N2O3S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethylanilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(CSCCCNC(=O)CN(c2cc(C)ccc2C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H32N2O3S2/c1-21-9-7-10-24(17-21)20-33-16-8-15-28-27(30)19-29(26-18-22(2)13-14-23(26)3)34(31,32)25-11-5-4-6-12-25/h4-7,9-14,17-18H,8,15-16,19-20H2,1-3H3,(H,28,30) |
| InChIKey | ODEQRQYAMJNGKD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|