C28H34N2O3S2 — CID 30212193
2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30212193) has the molecular formula C28H34N2O3S2 and a molecular weight of 510.73 g/mol. Its IUPAC name is 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30212193 |
| Molecular Formula | C28H34N2O3S2 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccccc2C)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C28H34N2O3S2/c1-21-11-14-26(15-12-21)35(32,33)30(27-18-22(2)10-13-24(27)4)19-28(31)29-16-7-17-34-20-25-9-6-5-8-23(25)3/h5-6,8-15,18H,7,16-17,19-20H2,1-4H3,(H,29,31) |
| InChIKey | COSNCUDLVVRPCB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|