C27H32N2O4S2 — CID 30203029
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30203029) has the molecular formula C27H32N2O4S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30203029 |
| Molecular Formula | C27H32N2O4S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCCSCc1ccccc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H32N2O4S2/c1-3-33-26-17-10-9-16-25(26)29(35(31,32)24-14-5-4-6-15-24)20-27(30)28-18-11-19-34-21-23-13-8-7-12-22(23)2/h4-10,12-17H,3,11,18-21H2,1-2H3,(H,28,30) |
| InChIKey | CNAIKNKOTJODFY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|