C26H29ClN2O4S2 — CID 43892502
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43892502) has the molecular formula C26H29ClN2O4S2 and a molecular weight of 533.12 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43892502 |
| Molecular Formula | C26H29ClN2O4S2 |
| Molecular Weight | 533.12 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCCSCc1ccccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN2O4S2/c1-2-33-25-16-9-8-15-24(25)29(35(31,32)22-12-4-3-5-13-22)19-26(30)28-17-10-18-34-20-21-11-6-7-14-23(21)27/h3-9,11-16H,2,10,17-20H2,1H3,(H,28,30) |
| InChIKey | HBHHHQCWMWEVLQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.12 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|