C26H28Cl2N2O4S3 — CID 4001099
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 4001099) has the molecular formula C26H28Cl2N2O4S3 and a molecular weight of 599.63 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4001099 |
| Molecular Formula | C26H28Cl2N2O4S3 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCSCc1c(Cl)cccc1Cl)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O4S3/c1-3-34-25-10-5-4-9-24(25)30(37(32,33)20-13-11-19(35-2)12-14-20)17-26(31)29-15-16-36-18-21-22(27)7-6-8-23(21)28/h4-14H,3,15-18H2,1-2H3,(H,29,31) |
| InChIKey | RVDMJVXNZZGQLJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|