C26H29ClN2O4S3 — CID 3552584
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 3552584) has the molecular formula C26H29ClN2O4S3 and a molecular weight of 565.18 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3552584 |
| Molecular Formula | C26H29ClN2O4S3 |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCSCc1cccc(Cl)c1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C26H29ClN2O4S3/c1-3-33-25-10-5-4-9-24(25)29(36(31,32)23-13-11-22(34-2)12-14-23)18-26(30)28-15-16-35-19-20-7-6-8-21(27)17-20/h4-14,17H,3,15-16,18-19H2,1-2H3,(H,28,30) |
| InChIKey | ZKBLSPQUPMNYMP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|