C25H25Cl2FN2O4S2 — CID 126175196
N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide (PubChem CID 126175196) has the molecular formula C25H25Cl2FN2O4S2 and a molecular weight of 571.52 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide.
| Compound Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126175196 |
| Molecular Formula | C25H25Cl2FN2O4S2 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCSCc1c(F)cccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25Cl2FN2O4S2/c1-2-34-24-9-4-3-8-23(24)30(36(32,33)19-12-10-18(26)11-13-19)16-25(31)29-14-15-35-17-20-21(27)6-5-7-22(20)28/h3-13H,2,14-17H2,1H3,(H,29,31) |
| InChIKey | VFNJQNDKHZQPHY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|