C23H21ClF2N2O3S2 — CID 126033153
2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126033153) has the molecular formula C23H21ClF2N2O3S2 and a molecular weight of 511.02 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126033153 |
| Molecular Formula | C23H21ClF2N2O3S2 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1ccccc1)NCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H21ClF2N2O3S2/c24-19-9-6-11-20(25)18(19)16-32-14-13-27-23(29)15-28(22-12-5-4-10-21(22)26)33(30,31)17-7-2-1-3-8-17/h1-12H,13-16H2,(H,27,29) |
| InChIKey | VAIBIWVNSGOEQN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|