C21H21FN2O4S2 — CID 17313004
2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 17313004) has the molecular formula C21H21FN2O4S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 17313004 |
| Molecular Formula | C21H21FN2O4S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1ccccc1)NCCSCc1ccco1 |
| InChI | InChI=1S/C21H21FN2O4S2/c22-19-10-4-5-11-20(19)24(30(26,27)18-8-2-1-3-9-18)15-21(25)23-12-14-29-16-17-7-6-13-28-17/h1-11,13H,12,14-16H2,(H,23,25) |
| InChIKey | GPKPCNIWJMORDN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|