C23H26N2O6S2 — CID 126172296
2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 126172296) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 126172296 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccco2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H26N2O6S2/c1-29-21-11-10-20(15-22(21)30-2)33(27,28)25(18-7-4-3-5-8-18)16-23(26)24-12-14-32-17-19-9-6-13-31-19/h3-11,13,15H,12,14,16-17H2,1-2H3,(H,24,26) |
| InChIKey | BZLRDBQIBYTQMA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|