C22H23FN2O4S3 — CID 30266590
2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 30266590) has the molecular formula C22H23FN2O4S3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30266590 |
| Molecular Formula | C22H23FN2O4S3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccco2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H23FN2O4S3/c1-30-20-7-9-21(10-8-20)32(27,28)25(18-5-2-4-17(23)14-18)15-22(26)24-11-13-31-16-19-6-3-12-29-19/h2-10,12,14H,11,13,15-16H2,1H3,(H,24,26) |
| InChIKey | PHAMKAZZQJJRBC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|