C25H30N2O5S3 — CID 43896762
2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 43896762) has the molecular formula C25H30N2O5S3 and a molecular weight of 534.73 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 43896762 |
| Molecular Formula | C25H30N2O5S3 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCSCc2ccco2)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O5S3/c1-3-31-21-9-7-20(8-10-21)27(35(29,30)24-13-11-23(33-2)12-14-24)18-25(28)26-15-5-17-34-19-22-6-4-16-32-22/h4,6-14,16H,3,5,15,17-19H2,1-2H3,(H,26,28) |
| InChIKey | SZSIDRCMIKKZLI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|