C24H28N2O5S2 — CID 53279122
2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-yl)propyl]acetamide (PubChem CID 53279122) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-yl)propyl]acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 53279122 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(furan-2-yl)propyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCc2ccco2)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O5S2/c1-3-30-21-10-8-19(9-11-21)26(33(28,29)23-14-12-22(32-2)13-15-23)18-24(27)25-16-4-6-20-7-5-17-31-20/h5,7-15,17H,3-4,6,16,18H2,1-2H3,(H,25,27) |
| InChIKey | DIWSKCNRUYKXCF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|