C28H33N3O4S2 — CID 43896749
N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 43896749) has the molecular formula C28H33N3O4S2 and a molecular weight of 539.72 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43896749 |
| Molecular Formula | C28H33N3O4S2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCN2CCc3ccccc32)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O4S2/c1-3-35-24-11-9-23(10-12-24)31(37(33,34)26-15-13-25(36-2)14-16-26)21-28(32)29-18-6-19-30-20-17-22-7-4-5-8-27(22)30/h4-5,7-16H,3,6,17-21H2,1-2H3,(H,29,32) |
| InChIKey | GZWSPVYVSXWTJJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|