C28H33N3O5S — CID 30215480
N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 30215480) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30215480 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCCN2CCc3ccccc32)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C28H33N3O5S/c1-21-9-12-24(13-10-21)37(33,34)31(23-11-14-26(35-2)27(19-23)36-3)20-28(32)29-16-6-17-30-18-15-22-7-4-5-8-25(22)30/h4-5,7-14,19H,6,15-18,20H2,1-3H3,(H,29,32) |
| InChIKey | IMDGRLFVPGUEIM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|