C26H30N2O5S2 — CID 30215519
2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 30215519) has the molecular formula C26H30N2O5S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30215519 |
| Molecular Formula | C26H30N2O5S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCCSc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C26H30N2O5S2/c1-20-10-13-23(14-11-20)35(30,31)28(21-12-15-24(32-2)25(18-21)33-3)19-26(29)27-16-7-17-34-22-8-5-4-6-9-22/h4-6,8-15,18H,7,16-17,19H2,1-3H3,(H,27,29) |
| InChIKey | AXJGJVJIHGTAPP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|