C26H30N2O3S3 — CID 30228198
2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide (PubChem CID 30228198) has the molecular formula C26H30N2O3S3 and a molecular weight of 514.74 g/mol. Its IUPAC name is 2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide.
| Compound Name | 2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 30228198 |
| Molecular Formula | C26H30N2O3S3 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)NCCCSc2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O3S3/c1-20-5-9-22(10-6-20)28(34(30,31)25-15-13-23(32-3)14-16-25)19-26(29)27-17-4-18-33-24-11-7-21(2)8-12-24/h5-16H,4,17-19H2,1-3H3,(H,27,29) |
| InChIKey | JZYNOWZPAKZQED-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|