C24H25FN2O3S3 — CID 30263009
2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 30263009) has the molecular formula C24H25FN2O3S3 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 30263009 |
| Molecular Formula | C24H25FN2O3S3 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-(3-fluoro-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)NCCSc2ccc(C)cc2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H25FN2O3S3/c1-18-6-8-22(9-7-18)32-15-14-26-24(28)17-27(20-5-3-4-19(25)16-20)33(29,30)23-12-10-21(31-2)11-13-23/h3-13,16H,14-15,17H2,1-2H3,(H,26,28) |
| InChIKey | WXZYPHVCMXSUSU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|