C23H23BrN2O3S2 — CID 51344104
2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 51344104) has the molecular formula C23H23BrN2O3S2 and a molecular weight of 519.49 g/mol. Its IUPAC name is 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 51344104 |
| Molecular Formula | C23H23BrN2O3S2 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSc2ccccc2)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H23BrN2O3S2/c1-18-10-12-22(13-11-18)31(28,29)26(20-7-5-6-19(24)16-20)17-23(27)25-14-15-30-21-8-3-2-4-9-21/h2-13,16H,14-15,17H2,1H3,(H,25,27) |
| InChIKey | JUAKDHFPMYJVOY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|