C19H23BrN2O3S — CID 126116858
2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-butylacetamide (PubChem CID 126116858) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-butylacetamide.
| Compound Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-butylacetamide |
|---|---|
| PubChem CID | 126116858 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-butylacetamide |
| SMILES | CCCCNC(=O)CN(c1cccc(Br)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23BrN2O3S/c1-3-4-12-21-19(23)14-22(17-7-5-6-16(20)13-17)26(24,25)18-10-8-15(2)9-11-18/h5-11,13H,3-4,12,14H2,1-2H3,(H,21,23) |
| InChIKey | DRGWLDFYFADFFK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|