C30H36BrN3O4S — CID 133151819
2-[(3-bromophenyl)methyl-[2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133151819) has the molecular formula C30H36BrN3O4S and a molecular weight of 614.61 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151819 |
| Molecular Formula | C30H36BrN3O4S |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H36BrN3O4S/c1-5-6-18-32-30(36)24(4)33(20-25-8-7-9-26(31)19-25)29(35)21-34(27-14-10-22(2)11-15-27)39(37,38)28-16-12-23(3)13-17-28/h7-17,19,24H,5-6,18,20-21H2,1-4H3,(H,32,36) |
| InChIKey | TVSARWBHHRWGPR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|