C30H35Br2N3O5S — CID 133151900
2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 133151900) has the molecular formula C30H35Br2N3O5S and a molecular weight of 709.50 g/mol. Its IUPAC name is 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151900 |
| Molecular Formula | C30H35Br2N3O5S |
| Molecular Weight | 709.50 g/mol |
| Exact Mass | 707.07 |
| IUPAC Name | 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C30H35Br2N3O5S/c1-5-6-16-33-30(37)22(3)34(19-23-8-7-9-24(31)17-23)29(36)20-35(25-12-10-21(2)11-13-25)41(38,39)26-14-15-28(40-4)27(32)18-26/h7-15,17-18,22H,5-6,16,19-20H2,1-4H3,(H,33,37) |
| InChIKey | DCMSLFOIEXMZHY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|