C30H35BrFN3O5S — CID 100561310
(2R)-2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 100561310) has the molecular formula C30H35BrFN3O5S and a molecular weight of 648.60 g/mol. Its IUPAC name is (2R)-2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | (2R)-2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100561310 |
| Molecular Formula | C30H35BrFN3O5S |
| Molecular Weight | 648.60 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | (2R)-2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C30H35BrFN3O5S/c1-5-6-17-33-30(37)22(3)34(19-23-9-7-8-10-27(23)32)29(36)20-35(24-13-11-21(2)12-14-24)41(38,39)25-15-16-28(40-4)26(31)18-25/h7-16,18,22H,5-6,17,19-20H2,1-4H3,(H,33,37)/t22-/m1/s1 |
| InChIKey | FTDCJOLWOQPTDR-JOCHJYFZSA-N |
| XLogP | 5.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|