C31H38FN3O6S — CID 100561126
(2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100561126) has the molecular formula C31H38FN3O6S and a molecular weight of 599.73 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100561126 |
| Molecular Formula | C31H38FN3O6S |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H38FN3O6S/c1-6-7-18-33-31(37)23(3)34(20-24-10-8-9-11-27(24)32)30(36)21-35(25-14-12-22(2)13-15-25)42(38,39)26-16-17-28(40-4)29(19-26)41-5/h8-17,19,23H,6-7,18,20-21H2,1-5H3,(H,33,37)/t23-/m1/s1 |
| InChIKey | HAGWVYQMOBBGRC-HSZRJFAPSA-N |
| XLogP | 4.68 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|