C32H40FN3O6S — CID 100561237
(2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100561237) has the molecular formula C32H40FN3O6S and a molecular weight of 613.75 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100561237 |
| Molecular Formula | C32H40FN3O6S |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40FN3O6S/c1-7-8-15-34-32(38)24(4)35(20-25-11-9-10-12-28(25)33)31(37)21-36(26-17-22(2)16-23(3)18-26)43(39,40)27-13-14-29(41-5)30(19-27)42-6/h9-14,16-19,24H,7-8,15,20-21H2,1-6H3,(H,34,38)/t24-/m0/s1 |
| InChIKey | TUYMBCLLQOMDPU-DEOSSOPVSA-N |
| XLogP | 4.99 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|