C33H43N3O7S — CID 132754912
N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132754912) has the molecular formula C33H43N3O7S and a molecular weight of 625.79 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132754912 |
| Molecular Formula | C33H43N3O7S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H43N3O7S/c1-8-9-16-34-33(38)25(4)35(21-26-10-12-28(41-5)13-11-26)32(37)22-36(27-18-23(2)17-24(3)19-27)44(39,40)29-14-15-30(42-6)31(20-29)43-7/h10-15,17-20,25H,8-9,16,21-22H2,1-7H3,(H,34,38) |
| InChIKey | KMJVBNJTEASYCD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|