C34H45N3O6S — CID 132754421
N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 132754421) has the molecular formula C34H45N3O6S and a molecular weight of 623.82 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132754421 |
| Molecular Formula | C34H45N3O6S |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C34H45N3O6S/c1-8-10-17-35-34(39)30(9-2)36(22-27-13-11-24(3)12-14-27)33(38)23-37(28-19-25(4)18-26(5)20-28)44(40,41)29-15-16-31(42-6)32(21-29)43-7/h11-16,18-21,30H,8-10,17,22-23H2,1-7H3,(H,35,39) |
| InChIKey | DBJKSMSUOFGBRI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|