C38H44ClN3O6S — CID 100635901
(2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100635901) has the molecular formula C38H44ClN3O6S and a molecular weight of 706.31 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100635901 |
| Molecular Formula | C38H44ClN3O6S |
| Molecular Weight | 706.31 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C38H44ClN3O6S/c1-6-7-19-40-38(44)34(23-29-11-9-8-10-12-29)41(25-30-13-15-31(39)16-14-30)37(43)26-42(32-21-27(2)20-28(3)22-32)49(45,46)33-17-18-35(47-4)36(24-33)48-5/h8-18,20-22,24,34H,6-7,19,23,25-26H2,1-5H3,(H,40,44)/t34-/m0/s1 |
| InChIKey | PGQPQBGLCRNCBC-UMSFTDKQSA-N |
| XLogP | 6.73 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.31 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|