C36H39ClFN3O6S — CID 100648484
(2R)-N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100648484) has the molecular formula C36H39ClFN3O6S and a molecular weight of 696.24 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100648484 |
| Molecular Formula | C36H39ClFN3O6S |
| Molecular Weight | 696.24 g/mol |
| Exact Mass | 695.22 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C36H39ClFN3O6S/c1-4-5-21-39-36(43)32(22-26-11-7-6-8-12-26)40(24-27-13-9-10-14-31(27)38)35(42)25-41(29-17-15-28(37)16-18-29)48(44,45)30-19-20-33(46-2)34(23-30)47-3/h6-20,23,32H,4-5,21-22,24-25H2,1-3H3,(H,39,43)/t32-/m1/s1 |
| InChIKey | RQBJPXLJLGTAQW-JGCGQSQUSA-N |
| XLogP | 6.25 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.24 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|