C37H42ClN3O6S — CID 133152941
N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133152941) has the molecular formula C37H42ClN3O6S and a molecular weight of 692.28 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133152941 |
| Molecular Formula | C37H42ClN3O6S |
| Molecular Weight | 692.28 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | N-butyl-2-[[2-(4-chloro-N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1C)C(=O)CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C37H42ClN3O6S/c1-5-6-22-39-37(43)33(23-28-13-8-7-9-14-28)40(25-29-15-11-10-12-27(29)2)36(42)26-41(31-18-16-30(38)17-19-31)48(44,45)32-20-21-34(46-3)35(24-32)47-4/h7-21,24,33H,5-6,22-23,25-26H2,1-4H3,(H,39,43) |
| InChIKey | ZVIWMPLKUGEGSM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.28 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|