C39H47N3O6S — CID 100588168
(2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100588168) has the molecular formula C39H47N3O6S and a molecular weight of 685.89 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100588168 |
| Molecular Formula | C39H47N3O6S |
| Molecular Weight | 685.89 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C39H47N3O6S/c1-7-8-20-40-39(44)35(24-31-15-10-9-11-16-31)41(26-32-17-13-12-14-30(32)4)38(43)27-42(33-22-28(2)21-29(3)23-33)49(45,46)34-18-19-36(47-5)37(25-34)48-6/h9-19,21-23,25,35H,7-8,20,24,26-27H2,1-6H3,(H,40,44)/t35-/m0/s1 |
| InChIKey | JOZKLAFZXKTHLD-DHUJRADRSA-N |
| XLogP | 6.38 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|