C39H47N3O7S — CID 133204662
N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133204662) has the molecular formula C39H47N3O7S and a molecular weight of 701.89 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204662 |
| Molecular Formula | C39H47N3O7S |
| Molecular Weight | 701.89 g/mol |
| Exact Mass | 701.31 |
| IUPAC Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C39H47N3O7S/c1-7-8-19-40-39(44)35(24-30-13-10-9-11-14-30)41(26-31-15-12-16-33(23-31)47-4)38(43)27-42(32-21-28(2)20-29(3)22-32)50(45,46)34-17-18-36(48-5)37(25-34)49-6/h9-18,20-23,25,35H,7-8,19,24,26-27H2,1-6H3,(H,40,44) |
| InChIKey | UXNUEFGEWIUDCV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|