C39H47N3O8S — CID 100602851
(2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100602851) has the molecular formula C39H47N3O8S and a molecular weight of 717.89 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100602851 |
| Molecular Formula | C39H47N3O8S |
| Molecular Weight | 717.89 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C39H47N3O8S/c1-7-8-22-40-39(44)34(23-29-12-10-9-11-13-29)41(26-30-16-14-28(2)15-17-30)38(43)27-42(33-24-31(47-3)18-20-35(33)48-4)51(45,46)32-19-21-36(49-5)37(25-32)50-6/h9-21,24-25,34H,7-8,22-23,26-27H2,1-6H3,(H,40,44)/t34-/m1/s1 |
| InChIKey | PIQOMMIDNQAXEI-UUWRZZSWSA-N |
| XLogP | 5.78 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.89 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|