C38H45N3O6S — CID 100600621
(2R)-N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100600621) has the molecular formula C38H45N3O6S and a molecular weight of 671.86 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100600621 |
| Molecular Formula | C38H45N3O6S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H45N3O6S/c1-6-7-23-39-38(43)35(24-30-11-9-8-10-12-30)40(26-31-17-13-28(2)14-18-31)37(42)27-41(34-25-32(46-4)19-22-36(34)47-5)48(44,45)33-20-15-29(3)16-21-33/h8-22,25,35H,6-7,23-24,26-27H2,1-5H3,(H,39,43)/t35-/m1/s1 |
| InChIKey | CZGTWVYZHTZXKR-PGUFJCEWSA-N |
| XLogP | 6.07 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|