C38H44ClN3O8S — CID 133258844
N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133258844) has the molecular formula C38H44ClN3O8S and a molecular weight of 738.30 g/mol. Its IUPAC name is N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133258844 |
| Molecular Formula | C38H44ClN3O8S |
| Molecular Weight | 738.30 g/mol |
| Exact Mass | 737.25 |
| IUPAC Name | N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C38H44ClN3O8S/c1-6-7-20-40-38(44)33(22-27-12-9-8-10-13-27)41(25-28-14-11-15-29(39)21-28)37(43)26-42(32-23-30(47-2)16-18-34(32)48-3)51(45,46)31-17-19-35(49-4)36(24-31)50-5/h8-19,21,23-24,33H,6-7,20,22,25-26H2,1-5H3,(H,40,44) |
| InChIKey | MUUWZUBLBBWSFS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.30 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|