C32H40ClN3O8S — CID 100554868
(2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]propanamide (PubChem CID 100554868) has the molecular formula C32H40ClN3O8S and a molecular weight of 662.21 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100554868 |
| Molecular Formula | C32H40ClN3O8S |
| Molecular Weight | 662.21 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40ClN3O8S/c1-7-8-16-34-32(38)22(2)35(20-23-10-9-11-24(33)17-23)31(37)21-36(27-18-25(41-3)12-14-28(27)42-4)45(39,40)26-13-15-29(43-5)30(19-26)44-6/h9-15,17-19,22H,7-8,16,20-21H2,1-6H3,(H,34,38)/t22-/m0/s1 |
| InChIKey | KUHMBGOBABKITO-QFIPXVFZSA-N |
| XLogP | 4.90 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|