C30H35ClFN3O6S — CID 100554822
(2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]propanamide (PubChem CID 100554822) has the molecular formula C30H35ClFN3O6S and a molecular weight of 620.14 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100554822 |
| Molecular Formula | C30H35ClFN3O6S |
| Molecular Weight | 620.14 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C30H35ClFN3O6S/c1-5-6-16-33-30(37)21(2)34(19-22-8-7-9-23(31)17-22)29(36)20-35(25-12-10-24(32)11-13-25)42(38,39)26-14-15-27(40-3)28(18-26)41-4/h7-15,17-18,21H,5-6,16,19-20H2,1-4H3,(H,33,37)/t21-/m1/s1 |
| InChIKey | FRXCZOQHSSTHCL-OAQYLSRUSA-N |
| XLogP | 5.03 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|