C31H37Cl2N3O7S — CID 100554087
(2S)-N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(3-chlorophenyl)methyl]amino]propanamide (PubChem CID 100554087) has the molecular formula C31H37Cl2N3O7S and a molecular weight of 666.62 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(3-chlorophenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(3-chlorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100554087 |
| Molecular Formula | C31H37Cl2N3O7S |
| Molecular Weight | 666.62 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(3-chlorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H37Cl2N3O7S/c1-6-7-15-34-31(38)21(2)35(19-22-9-8-10-23(32)16-22)30(37)20-36(26-17-24(33)11-13-27(26)41-3)44(39,40)25-12-14-28(42-4)29(18-25)43-5/h8-14,16-18,21H,6-7,15,19-20H2,1-5H3,(H,34,38)/t21-/m0/s1 |
| InChIKey | HTRJDWOQZYVNDJ-NRFANRHFSA-N |
| XLogP | 5.55 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|