C32H40ClN3O7S — CID 132757159
N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide (PubChem CID 132757159) has the molecular formula C32H40ClN3O7S and a molecular weight of 646.21 g/mol. Its IUPAC name is N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132757159 |
| Molecular Formula | C32H40ClN3O7S |
| Molecular Weight | 646.21 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1C)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40ClN3O7S/c1-7-8-17-34-32(38)23(3)35(20-24-12-10-9-11-22(24)2)31(37)21-36(27-18-25(33)13-15-28(27)41-4)44(39,40)26-14-16-29(42-5)30(19-26)43-6/h9-16,18-19,23H,7-8,17,20-21H2,1-6H3,(H,34,38) |
| InChIKey | FOZRXYHOFTVDAH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|