C33H42ClN3O7S — CID 132758239
N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 132758239) has the molecular formula C33H42ClN3O7S and a molecular weight of 660.23 g/mol. Its IUPAC name is N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132758239 |
| Molecular Formula | C33H42ClN3O7S |
| Molecular Weight | 660.23 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | N-butyl-2-[[2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1C)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H42ClN3O7S/c1-7-9-18-35-33(39)27(8-2)36(21-24-13-11-10-12-23(24)3)32(38)22-37(28-19-25(34)14-16-29(28)42-4)45(40,41)26-15-17-30(43-5)31(20-26)44-6/h10-17,19-20,27H,7-9,18,21-22H2,1-6H3,(H,35,39) |
| InChIKey | QJODTSGIQRBBJG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.23 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|