C32H41N3O7S — CID 132752543
N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132752543) has the molecular formula C32H41N3O7S and a molecular weight of 611.76 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132752543 |
| Molecular Formula | C32H41N3O7S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | N-butyl-2-[[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H41N3O7S/c1-7-8-18-33-32(37)24(3)34(21-25-10-9-11-26(19-25)40-4)31(36)22-35(29-20-27(41-5)14-17-30(29)42-6)43(38,39)28-15-12-23(2)13-16-28/h9-17,19-20,24H,7-8,18,21-22H2,1-6H3,(H,33,37) |
| InChIKey | FERMJGREWOOJTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|