C31H37Cl2N3O6S — CID 132757483
N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide (PubChem CID 132757483) has the molecular formula C31H37Cl2N3O6S and a molecular weight of 650.63 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132757483 |
| Molecular Formula | C31H37Cl2N3O6S |
| Molecular Weight | 650.63 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H37Cl2N3O6S/c1-6-7-17-34-31(38)22(3)35(19-25-26(32)9-8-10-27(25)33)30(37)20-36(28-18-23(41-4)13-16-29(28)42-5)43(39,40)24-14-11-21(2)12-15-24/h8-16,18,22H,6-7,17,19-20H2,1-5H3,(H,34,38) |
| InChIKey | LJHWFNGNDPZLFI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|