C25H33Cl2N3O5S — CID 132740638
N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 132740638) has the molecular formula C25H33Cl2N3O5S and a molecular weight of 558.53 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132740638 |
| Molecular Formula | C25H33Cl2N3O5S |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(C)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H33Cl2N3O5S/c1-6-7-13-28-25(32)18(3)29(15-19-20(26)9-8-10-21(19)27)24(31)16-30(36(5,33)34)22-14-17(2)11-12-23(22)35-4/h8-12,14,18H,6-7,13,15-16H2,1-5H3,(H,28,32) |
| InChIKey | HJBZVHNHWWKAIA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|