C26H37N3O6S — CID 132730924
N-butyl-2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide (PubChem CID 132730924) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132730924 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-butyl-2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(OC)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C26H37N3O6S/c1-7-8-15-27-26(31)20(3)28(17-21-11-9-19(2)10-12-21)25(30)18-29(36(6,32)33)23-16-22(34-4)13-14-24(23)35-5/h9-14,16,20H,7-8,15,17-18H2,1-6H3,(H,27,31) |
| InChIKey | XUOYBIHPKNRBRQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|