C25H35N3O6S — CID 132727033
N-butyl-2-[[2-(2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132727033) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132727033 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | N-butyl-2-[[2-(2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H35N3O6S/c1-6-7-16-26-25(30)19(2)27(17-20-12-14-21(33-3)15-13-20)24(29)18-28(35(5,31)32)22-10-8-9-11-23(22)34-4/h8-15,19H,6-7,16-18H2,1-5H3,(H,26,30) |
| InChIKey | VVOQFKQHJKJPHN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|