C26H37N3O5S — CID 132726570
N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132726570) has the molecular formula C26H37N3O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132726570 |
| Molecular Formula | C26H37N3O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccccc1CC)S(C)(=O)=O |
| InChI | InChI=1S/C26H37N3O5S/c1-6-8-17-27-26(31)20(3)28(18-21-13-15-23(34-4)16-14-21)25(30)19-29(35(5,32)33)24-12-10-9-11-22(24)7-2/h9-16,20H,6-8,17-19H2,1-5H3,(H,27,31) |
| InChIKey | LAPGVZTWDWYANK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|