C25H34FN3O4S — CID 100560411
(2R)-N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100560411) has the molecular formula C25H34FN3O4S and a molecular weight of 491.63 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100560411 |
| Molecular Formula | C25H34FN3O4S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2-ethyl-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccccc1CC)S(C)(=O)=O |
| InChI | InChI=1S/C25H34FN3O4S/c1-5-7-16-27-25(31)19(3)28(17-21-13-8-10-14-22(21)26)24(30)18-29(34(4,32)33)23-15-11-9-12-20(23)6-2/h8-15,19H,5-7,16-18H2,1-4H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | CBTAZXNZAJIQPE-LJQANCHMSA-N |
| XLogP | 3.49 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|