C24H32FN3O5S — CID 100561677
(2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 100561677) has the molecular formula C24H32FN3O5S and a molecular weight of 493.60 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100561677 |
| Molecular Formula | C24H32FN3O5S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C24H32FN3O5S/c1-5-6-15-26-24(30)18(2)27(16-19-11-7-8-12-20(19)25)23(29)17-28(34(4,31)32)21-13-9-10-14-22(21)33-3/h7-14,18H,5-6,15-17H2,1-4H3,(H,26,30)/t18-/m1/s1 |
| InChIKey | QLAQDQMUMBWOBD-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|