C24H31ClFN3O5S — CID 133151587
N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 133151587) has the molecular formula C24H31ClFN3O5S and a molecular weight of 528.05 g/mol. Its IUPAC name is N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 133151587 |
| Molecular Formula | C24H31ClFN3O5S |
| Molecular Weight | 528.05 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1F)C(=O)CN(c1cc(Cl)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C24H31ClFN3O5S/c1-5-6-13-27-24(31)17(2)28(15-18-9-7-8-10-20(18)26)23(30)16-29(35(4,32)33)21-14-19(25)11-12-22(21)34-3/h7-12,14,17H,5-6,13,15-16H2,1-4H3,(H,27,31) |
| InChIKey | JGUMQDLFMWBDIW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.05 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|