C25H33F2N3O4S — CID 100564499
N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 100564499) has the molecular formula C25H33F2N3O4S and a molecular weight of 509.62 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100564499 |
| Molecular Formula | C25H33F2N3O4S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(2-fluoro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)CCCN(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C25H33F2N3O4S/c1-4-5-16-28-25(32)19(2)29(18-20-11-6-7-12-21(20)26)24(31)15-10-17-30(35(3,33)34)23-14-9-8-13-22(23)27/h6-9,11-14,19H,4-5,10,15-18H2,1-3H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | WGEIODVBOYEZAN-IBGZPJMESA-N |
| XLogP | 3.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|